About 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol
5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol (PubChem CID 130066947) has the molecular formula C6H3Cl2N3O
and a molecular weight of 204.02 g/mol. Its IUPAC name is 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol.
Molecular Properties
| Compound Name | 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol |
| PubChem CID | 130066947 |
| Molecular Formula | C6H3Cl2N3O |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol |
| SMILES | Oc1cn2c(Cl)cc(Cl)nc2n1 |
| InChI | InChI=1S/C6H3Cl2N3O/c7-3-1-4(8)11-2-5(12)10-6(11)9-3/h1-2,12H |
| InChIKey | VELHHFYJLUWZST-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol?
The IUPAC name of 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol (CID 130066947) is 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol.
What is the SMILES notation for 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol?
The canonical SMILES for 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol is Oc1cn2c(Cl)cc(Cl)nc2n1.
What is the InChIKey of 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol?
The InChIKey is VELHHFYJLUWZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3O/c7-3-1-4(8)11-2-5(12)10-6(11)9-3/h1-2,12H.
What are the key properties of 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol?
5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol has a molecular weight of 204.02 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloroimidazo[1,2-a]pyrimidin-2-ol is sourced from PubChem (CID 130066947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).