About 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid
1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid (PubChem CID 130067287) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid.
Analyze 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid?
The IUPAC name of 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid (CID 130067287) is 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid.
What is the SMILES notation for 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid?
The canonical SMILES for 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid is O=C(O)c1cnc2c(c1)COCCN2.
What is the InChIKey of 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid?
The InChIKey is FXJINTCHWCFEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-9(13)6-3-7-5-14-2-1-10-8(7)11-4-6/h3-4H,1-2,5H2,(H,10,11)(H,12,13).
What are the key properties of 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid?
1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,5-tetrahydropyrido[2,3-e][1,4]oxazepine-7-carboxylic acid is sourced from PubChem (CID 130067287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).