C11H10FN — CID 130067326
6-fluoro-5-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5,10-tetraene (PubChem CID 130067326) has the molecular formula C11H10FN and a molecular weight of 175.21 g/mol. Its IUPAC name is 6-fluoro-5-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5,10-tetraene.
| Compound Name | 6-fluoro-5-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5,10-tetraene |
|---|---|
| PubChem CID | 130067326 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-fluoro-5-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5,10-tetraene |
| SMILES | Fc1nccc2c1CC1C=CC2C1 |
| InChI | InChI=1S/C11H10FN/c12-11-10-6-7-1-2-8(5-7)9(10)3-4-13-11/h1-4,7-8H,5-6H2 |
| InChIKey | VZLJZFAIDNJLMV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|