C10H19BO4 — CID 130067615
2-(1,4-dioxan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 130067615) has the molecular formula C10H19BO4 and a molecular weight of 214.07 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,4-dioxan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 130067615 |
| Molecular Formula | C10H19BO4 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2COCCO2)OC1(C)C |
| InChI | InChI=1S/C10H19BO4/c1-9(2)10(3,4)15-11(14-9)8-7-12-5-6-13-8/h8H,5-7H2,1-4H3 |
| InChIKey | LBYNRZXPAOCFGY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|