About 6,6-dimethyl-1,4-dioxane-2-carbaldehyde
6,6-dimethyl-1,4-dioxane-2-carbaldehyde (PubChem CID 130068068) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 6,6-dimethyl-1,4-dioxane-2-carbaldehyde.
Molecular Properties
| Compound Name | 6,6-dimethyl-1,4-dioxane-2-carbaldehyde |
| PubChem CID | 130068068 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 6,6-dimethyl-1,4-dioxane-2-carbaldehyde |
| SMILES | CC1(C)COCC(C=O)O1 |
| InChI | InChI=1S/C7H12O3/c1-7(2)5-9-4-6(3-8)10-7/h3,6H,4-5H2,1-2H3 |
| InChIKey | HJXUHEYEVNTSHL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-1,4-dioxane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1,4-dioxane-2-carbaldehyde?
The IUPAC name of 6,6-dimethyl-1,4-dioxane-2-carbaldehyde (CID 130068068) is 6,6-dimethyl-1,4-dioxane-2-carbaldehyde.
What is the SMILES notation for 6,6-dimethyl-1,4-dioxane-2-carbaldehyde?
The canonical SMILES for 6,6-dimethyl-1,4-dioxane-2-carbaldehyde is CC1(C)COCC(C=O)O1.
What is the InChIKey of 6,6-dimethyl-1,4-dioxane-2-carbaldehyde?
The InChIKey is HJXUHEYEVNTSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-7(2)5-9-4-6(3-8)10-7/h3,6H,4-5H2,1-2H3.
What are the key properties of 6,6-dimethyl-1,4-dioxane-2-carbaldehyde?
6,6-dimethyl-1,4-dioxane-2-carbaldehyde has a molecular weight of 144.17 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1,4-dioxane-2-carbaldehyde is sourced from PubChem (CID 130068068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).