C8H6BrF5N2 — CID 130069997
[6-bromo-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]methanamine (PubChem CID 130069997) has the molecular formula C8H6BrF5N2 and a molecular weight of 305.04 g/mol. Its IUPAC name is [6-bromo-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]methanamine.
| Compound Name | [6-bromo-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130069997 |
| Molecular Formula | C8H6BrF5N2 |
| Molecular Weight | 305.04 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | [6-bromo-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]methanamine |
| SMILES | NCc1cc(C(F)F)c(C(F)(F)F)c(Br)n1 |
| InChI | InChI=1S/C8H6BrF5N2/c9-6-5(8(12,13)14)4(7(10)11)1-3(2-15)16-6/h1,7H,2,15H2 |
| InChIKey | ZLBLPHWENXKHGC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.04 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|