C9H8BrF2N3 — CID 130070050
2-[4-(aminomethyl)-6-bromo-5-(difluoromethyl)-3-pyridinyl]acetonitrile (PubChem CID 130070050) has the molecular formula C9H8BrF2N3 and a molecular weight of 276.08 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-6-bromo-5-(difluoromethyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(aminomethyl)-6-bromo-5-(difluoromethyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130070050 |
| Molecular Formula | C9H8BrF2N3 |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 2-[4-(aminomethyl)-6-bromo-5-(difluoromethyl)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1cnc(Br)c(C(F)F)c1CN |
| InChI | InChI=1S/C9H8BrF2N3/c10-8-7(9(11)12)6(3-14)5(1-2-13)4-15-8/h4,9H,1,3,14H2 |
| InChIKey | XVYMKMHQAZPUBY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|