C9H6Br2F2N2 — CID 130070239
2-[3-bromo-5-(bromomethyl)-6-(difluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 130070239) has the molecular formula C9H6Br2F2N2 and a molecular weight of 339.97 g/mol. Its IUPAC name is 2-[3-bromo-5-(bromomethyl)-6-(difluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3-bromo-5-(bromomethyl)-6-(difluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130070239 |
| Molecular Formula | C9H6Br2F2N2 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.89 |
| IUPAC Name | 2-[3-bromo-5-(bromomethyl)-6-(difluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(C(F)F)c(CBr)cc1Br |
| InChI | InChI=1S/C9H6Br2F2N2/c10-4-5-3-6(11)7(1-2-14)15-8(5)9(12)13/h3,9H,1,4H2 |
| InChIKey | AVNUQPHSYHULKK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|