About (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate
(3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate (PubChem CID 13007394) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate |
| PubChem CID | 13007394 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H20O4/c1-9(2)11(15)18-14-5-10-3-12(16,7-14)6-13(17,4-10)8-14/h10,16-17H,1,3-8H2,2H3 |
| InChIKey | HFLCKUMNXPOLSN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate?
The IUPAC name of (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate (CID 13007394) is (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate.
What is the SMILES notation for (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate?
The canonical SMILES for (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate is C=C(C)C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate?
The InChIKey is HFLCKUMNXPOLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-9(2)11(15)18-14-5-10-3-12(16,7-14)6-13(17,4-10)8-14/h10,16-17H,1,3-8H2,2H3.
What are the key properties of (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate?
(3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate has a molecular weight of 252.31 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dihydroxy-1-adamantyl) 2-methylprop-2-enoate is sourced from PubChem (CID 13007394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).