About 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline
4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline (PubChem CID 13007572) has the molecular formula C18H19N3
and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline.
Molecular Properties
| Compound Name | 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline |
| PubChem CID | 13007572 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3/c1-3-14-21(15-4-2)18-12-10-17(11-13-18)20-19-16-8-6-5-7-9-16/h3-13H,1-2,14-15H2/b20-19+ |
| InChIKey | MZQCKOVZWODLOY-FMQUCBEESA-N |
| XLogP | 5.28 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline?
The IUPAC name of 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline (CID 13007572) is 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline.
What is the SMILES notation for 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline?
The canonical SMILES for 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline is C=CCN(CC=C)c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline?
The InChIKey is MZQCKOVZWODLOY-FMQUCBEESA-N. The full InChI is InChI=1S/C18H19N3/c1-3-14-21(15-4-2)18-12-10-17(11-13-18)20-19-16-8-6-5-7-9-16/h3-13H,1-2,14-15H2/b20-19+.
What are the key properties of 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline?
4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline has a molecular weight of 277.37 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenyl-N,N-bis(prop-2-enyl)aniline is sourced from PubChem (CID 13007572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).