C26H29Cl2N7O10S3 — CID 13007617
4-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonic acid (PubChem CID 13007617) has the molecular formula C26H29Cl2N7O10S3 and a molecular weight of 766.66 g/mol. Its IUPAC name is 4-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonic acid.
| Compound Name | 4-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 13007617 |
| Molecular Formula | C26H29Cl2N7O10S3 |
| Molecular Weight | 766.66 g/mol |
| Exact Mass | 765.05 |
| IUPAC Name | 4-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonic acid |
| SMILES | CC(=O)Nc1cc(N(CCCCS(=O)(=O)O)CCCCS(=O)(=O)O)ccc1/N=N/c1c(C#N)cnn1-c1c(Cl)cc(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C26H29Cl2N7O10S3/c1-17(36)31-24-12-19(34(8-2-4-10-46(37,38)39)9-3-5-11-47(40,41)42)6-7-23(24)32-33-26-18(15-29)16-30-35(26)25-21(27)13-20(14-22(25)28)48(43,44)45/h6-7,12-14,16H,2-5,8-11H2,1H3,(H,31,36)(H,37,38,39)(H,40,41,42)(H,43,44,45)/b33-32+ |
| InChIKey | AVCRFJOZDRDZMV-ULIFNZDWSA-N |
| XLogP | 4.81 |
| TPSA | 261.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|