C28H34Cl2N8O4S — CID 13007626
4-[3-acetamido-4-[[1-(4-amino-2,6-dichlorophenyl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonic acid (PubChem CID 13007626) has the molecular formula C28H34Cl2N8O4S and a molecular weight of 649.61 g/mol. Its IUPAC name is 4-[3-acetamido-4-[[1-(4-amino-2,6-dichlorophenyl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonic acid.
| Compound Name | 4-[3-acetamido-4-[[1-(4-amino-2,6-dichlorophenyl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 13007626 |
| Molecular Formula | C28H34Cl2N8O4S |
| Molecular Weight | 649.61 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | 4-[3-acetamido-4-[[1-(4-amino-2,6-dichlorophenyl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonic acid |
| SMILES | CCN(CCCCS(=O)(=O)O)c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc(N)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C28H34Cl2N8O4S/c1-6-37(11-7-8-12-43(40,41)42)19-9-10-23(24(15-19)33-17(2)39)34-35-27-20(16-31)26(28(3,4)5)36-38(27)25-21(29)13-18(32)14-22(25)30/h9-10,13-15H,6-8,11-12,32H2,1-5H3,(H,33,39)(H,40,41,42)/b35-34+ |
| InChIKey | AWFAWCPEAQSRBN-XAHDOWKMSA-N |
| XLogP | 6.80 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|