C31H45S2+ — CID 13007663
2,6-ditert-butyl-4-[(1E,3E)-5-(2,6-ditert-butylthiopyran-4-ylidene)penta-1,3-dienyl]thiopyrylium (PubChem CID 13007663) has the molecular formula C31H45S2+ and a molecular weight of 481.84 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(1E,3E)-5-(2,6-ditert-butylthiopyran-4-ylidene)penta-1,3-dienyl]thiopyrylium.
| Compound Name | 2,6-ditert-butyl-4-[(1E,3E)-5-(2,6-ditert-butylthiopyran-4-ylidene)penta-1,3-dienyl]thiopyrylium |
|---|---|
| PubChem CID | 13007663 |
| Molecular Formula | C31H45S2+ |
| Molecular Weight | 481.84 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | 2,6-ditert-butyl-4-[(1E,3E)-5-(2,6-ditert-butylthiopyran-4-ylidene)penta-1,3-dienyl]thiopyrylium |
| SMILES | CC(C)(C)C1=CC(=C/C=C/C=C/c2cc(C(C)(C)C)[s+]c(C(C)(C)C)c2)C=C(C(C)(C)C)S1 |
| InChI | InChI=1S/C31H45S2/c1-28(2,3)24-18-22(19-25(32-24)29(4,5)6)16-14-13-15-17-23-20-26(30(7,8)9)33-27(21-23)31(10,11)12/h13-21H,1-12H3/q+1 |
| InChIKey | PDUYWAPPRCFRKU-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.84 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|