C8H4F2N2O2 — CID 130076831
6-(difluoromethyl)-3-formyl-4-oxo-1H-pyridine-2-carbonitrile (PubChem CID 130076831) has the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-formyl-4-oxo-1H-pyridine-2-carbonitrile.
| Compound Name | 6-(difluoromethyl)-3-formyl-4-oxo-1H-pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130076831 |
| Molecular Formula | C8H4F2N2O2 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 6-(difluoromethyl)-3-formyl-4-oxo-1H-pyridine-2-carbonitrile |
| SMILES | N#Cc1[nH]c(C(F)F)cc(=O)c1C=O |
| InChI | InChI=1S/C8H4F2N2O2/c9-8(10)5-1-7(14)4(3-13)6(2-11)12-5/h1,3,8H,(H,12,14) |
| InChIKey | QCUQYDSKUPXWSX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|