C9H9F2N3 — CID 130078176
6-(aminomethyl)-2-(difluoromethyl)-3-methylpyridine-4-carbonitrile (PubChem CID 130078176) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(difluoromethyl)-3-methylpyridine-4-carbonitrile.
| Compound Name | 6-(aminomethyl)-2-(difluoromethyl)-3-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130078176 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 6-(aminomethyl)-2-(difluoromethyl)-3-methylpyridine-4-carbonitrile |
| SMILES | Cc1c(C#N)cc(CN)nc1C(F)F |
| InChI | InChI=1S/C9H9F2N3/c1-5-6(3-12)2-7(4-13)14-8(5)9(10)11/h2,9H,4,13H2,1H3 |
| InChIKey | DSEGBAWVTHGNBE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |