About diethyl 2,2-dioctylpropanedioate
diethyl 2,2-dioctylpropanedioate (PubChem CID 13007935) has the molecular formula C23H44O4
and a molecular weight of 384.60 g/mol. Its IUPAC name is diethyl 2,2-dioctylpropanedioate.
Molecular Properties
| Compound Name | diethyl 2,2-dioctylpropanedioate |
| PubChem CID | 13007935 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | diethyl 2,2-dioctylpropanedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H44O4/c1-5-9-11-13-15-17-19-23(21(24)26-7-3,22(25)27-8-4)20-18-16-14-12-10-6-2/h5-20H2,1-4H3 |
| InChIKey | GUYMNPYVUJHUIV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,2-dioctylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,2-dioctylpropanedioate?
The IUPAC name of diethyl 2,2-dioctylpropanedioate (CID 13007935) is diethyl 2,2-dioctylpropanedioate.
What is the SMILES notation for diethyl 2,2-dioctylpropanedioate?
The canonical SMILES for diethyl 2,2-dioctylpropanedioate is CCCCCCCCC(CCCCCCCC)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2,2-dioctylpropanedioate?
The InChIKey is GUYMNPYVUJHUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O4/c1-5-9-11-13-15-17-19-23(21(24)26-7-3,22(25)27-8-4)20-18-16-14-12-10-6-2/h5-20H2,1-4H3.
What are the key properties of diethyl 2,2-dioctylpropanedioate?
diethyl 2,2-dioctylpropanedioate has a molecular weight of 384.60 g/mol, XLogP of 6.60, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,2-dioctylpropanedioate is sourced from PubChem (CID 13007935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).