C30H33N3O3 — CID 13008013
2-[5,9-bis(7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]cyclohepta-2,4,6-trien-1-one (PubChem CID 13008013) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[5,9-bis(7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-[5,9-bis(7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 13008013 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-[5,9-bis(7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]cyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cccccc1N1CCCN(c2cccccc2=O)CCCN(c2cccccc2=O)CCC1 |
| InChI | InChI=1S/C30H33N3O3/c34-28-16-7-1-4-13-25(28)31-19-10-21-32(26-14-5-2-8-17-29(26)35)23-12-24-33(22-11-20-31)27-15-6-3-9-18-30(27)36/h1-9,13-18H,10-12,19-24H2 |
| InChIKey | FPBJQJAJBZVZCP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |