C8H8F3NO2 — CID 130080748
[3-(difluoromethyl)-6-fluoro-2-methoxy-4-pyridinyl]methanol (PubChem CID 130080748) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is [3-(difluoromethyl)-6-fluoro-2-methoxy-4-pyridinyl]methanol.
| Compound Name | [3-(difluoromethyl)-6-fluoro-2-methoxy-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 130080748 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | [3-(difluoromethyl)-6-fluoro-2-methoxy-4-pyridinyl]methanol |
| SMILES | COc1nc(F)cc(CO)c1C(F)F |
| InChI | InChI=1S/C8H8F3NO2/c1-14-8-6(7(10)11)4(3-13)2-5(9)12-8/h2,7,13H,3H2,1H3 |
| InChIKey | QDYUSNHHQVMCQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|