About [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione
[1,4]benzodithiino[3,2-b]thianthrene-6,13-dione (PubChem CID 13008087) has the molecular formula C18H8O2S4
and a molecular weight of 384.53 g/mol. Its IUPAC name is [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione.
Molecular Properties
| Compound Name | [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione |
| PubChem CID | 13008087 |
| Molecular Formula | C18H8O2S4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione |
| SMILES | O=c1c2sc3ccccc3sc2c(=O)c2sc3ccccc3sc12 |
| InChI | InChI=1S/C18H8O2S4/c19-13-15-16(22-10-6-2-1-5-9(10)21-15)14(20)18-17(13)23-11-7-3-4-8-12(11)24-18/h1-8H |
| InChIKey | CUOUYYBYEAELJJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione?
The IUPAC name of [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione (CID 13008087) is [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione.
What is the SMILES notation for [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione?
The canonical SMILES for [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione is O=c1c2sc3ccccc3sc2c(=O)c2sc3ccccc3sc12.
What is the InChIKey of [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione?
The InChIKey is CUOUYYBYEAELJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8O2S4/c19-13-15-16(22-10-6-2-1-5-9(10)21-15)14(20)18-17(13)23-11-7-3-4-8-12(11)24-18/h1-8H.
What are the key properties of [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione?
[1,4]benzodithiino[3,2-b]thianthrene-6,13-dione has a molecular weight of 384.53 g/mol, XLogP of 5.83, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4]benzodithiino[3,2-b]thianthrene-6,13-dione is sourced from PubChem (CID 13008087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).