About 2,3-dibromo-9,10-dimethylanthracene
2,3-dibromo-9,10-dimethylanthracene (PubChem CID 13008114) has the molecular formula C16H12Br2
and a molecular weight of 364.08 g/mol. Its IUPAC name is 2,3-dibromo-9,10-dimethylanthracene.
Molecular Properties
| Compound Name | 2,3-dibromo-9,10-dimethylanthracene |
| PubChem CID | 13008114 |
| Molecular Formula | C16H12Br2 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 2,3-dibromo-9,10-dimethylanthracene |
| SMILES | Cc1c2ccccc2c(C)c2cc(Br)c(Br)cc12 |
| InChI | InChI=1S/C16H12Br2/c1-9-11-5-3-4-6-12(11)10(2)14-8-16(18)15(17)7-13(9)14/h3-8H,1-2H3 |
| InChIKey | SZXGVNLNLJYVNI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-9,10-dimethylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-9,10-dimethylanthracene?
The IUPAC name of 2,3-dibromo-9,10-dimethylanthracene (CID 13008114) is 2,3-dibromo-9,10-dimethylanthracene.
What is the SMILES notation for 2,3-dibromo-9,10-dimethylanthracene?
The canonical SMILES for 2,3-dibromo-9,10-dimethylanthracene is Cc1c2ccccc2c(C)c2cc(Br)c(Br)cc12.
What is the InChIKey of 2,3-dibromo-9,10-dimethylanthracene?
The InChIKey is SZXGVNLNLJYVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2/c1-9-11-5-3-4-6-12(11)10(2)14-8-16(18)15(17)7-13(9)14/h3-8H,1-2H3.
What are the key properties of 2,3-dibromo-9,10-dimethylanthracene?
2,3-dibromo-9,10-dimethylanthracene has a molecular weight of 364.08 g/mol, XLogP of 6.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-9,10-dimethylanthracene is sourced from PubChem (CID 13008114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).