C23H21BrN2O3 — CID 13008171
1-(6-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-yl)pyrrolidine-2,5-dione (PubChem CID 13008171) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is 1-(6-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(6-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 13008171 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 1-(6-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-yl)pyrrolidine-2,5-dione |
| SMILES | CN1c2ccc(N3C(=O)CCC3=O)cc2C(C)(C)C12C=Cc1cc(Br)ccc1O2 |
| InChI | InChI=1S/C23H21BrN2O3/c1-22(2)17-13-16(26-20(27)8-9-21(26)28)5-6-18(17)25(3)23(22)11-10-14-12-15(24)4-7-19(14)29-23/h4-7,10-13H,8-9H2,1-3H3 |
| InChIKey | YHEVDTJUJUPPLL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|