C31H34O8 — CID 13008214
5-[(2E,4E)-5-(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-yl)penta-2,4-dienylidene]spiro[1,3-dioxane-2,2'-adamantane]-4,6-dione (PubChem CID 13008214) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-yl)penta-2,4-dienylidene]spiro[1,3-dioxane-2,2'-adamantane]-4,6-dione.
| Compound Name | 5-[(2E,4E)-5-(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-yl)penta-2,4-dienylidene]spiro[1,3-dioxane-2,2'-adamantane]-4,6-dione |
|---|---|
| PubChem CID | 13008214 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 5-[(2E,4E)-5-(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-yl)penta-2,4-dienylidene]spiro[1,3-dioxane-2,2'-adamantane]-4,6-dione |
| SMILES | O=C1OC2(OC(=O)C1=C/C=C/C=C/C1=C(O)OC3(OC1=O)C1CC4CC(C1)CC3C4)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C31H34O8/c32-26-24(27(33)37-30(36-26)20-8-16-6-17(10-20)11-21(30)9-16)4-2-1-3-5-25-28(34)38-31(39-29(25)35)22-12-18-7-19(14-22)15-23(31)13-18/h1-5,16-23,32H,6-15H2/b3-1+,4-2+,25-5- |
| InChIKey | MHGNLPAVXXSCGC-ZZELPIJWSA-N |
| XLogP | 4.77 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|