C7H3F5INO — CID 130082730
3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-1H-pyridin-4-one (PubChem CID 130082730) has the molecular formula C7H3F5INO and a molecular weight of 339.00 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-1H-pyridin-4-one.
| Compound Name | 3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130082730 |
| Molecular Formula | C7H3F5INO |
| Molecular Weight | 339.00 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | 3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-1H-pyridin-4-one |
| SMILES | O=c1c(I)c[nH]c(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C7H3F5INO/c8-6(9)3-4(15)2(13)1-14-5(3)7(10,11)12/h1,6H,(H,14,15) |
| InChIKey | FCEUUQNODQBKGU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.00 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|