C29H22F6N4O4 — CID 13008425
4-amino-N-[5-[2-[3-[(4-aminobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 13008425) has the molecular formula C29H22F6N4O4 and a molecular weight of 604.51 g/mol. Its IUPAC name is 4-amino-N-[5-[2-[3-[(4-aminobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-amino-N-[5-[2-[3-[(4-aminobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 13008425 |
| Molecular Formula | C29H22F6N4O4 |
| Molecular Weight | 604.51 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 4-amino-N-[5-[2-[3-[(4-aminobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(C(c3ccc(O)c(NC(=O)c4ccc(N)cc4)c3)(C(F)(F)F)C(F)(F)F)ccc2O)cc1 |
| InChI | InChI=1S/C29H22F6N4O4/c30-28(31,32)27(29(33,34)35,17-5-11-23(40)21(13-17)38-25(42)15-1-7-19(36)8-2-15)18-6-12-24(41)22(14-18)39-26(43)16-3-9-20(37)10-4-16/h1-14,40-41H,36-37H2,(H,38,42)(H,39,43) |
| InChIKey | LDGUDGFIILODSV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|