C9H7ClF2INO2 — CID 130087657
2-[5-(chloromethyl)-6-(difluoromethyl)-3-iodo-2-pyridinyl]acetic acid (PubChem CID 130087657) has the molecular formula C9H7ClF2INO2 and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-6-(difluoromethyl)-3-iodo-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-(chloromethyl)-6-(difluoromethyl)-3-iodo-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 130087657 |
| Molecular Formula | C9H7ClF2INO2 |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | 2-[5-(chloromethyl)-6-(difluoromethyl)-3-iodo-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(C(F)F)c(CCl)cc1I |
| InChI | InChI=1S/C9H7ClF2INO2/c10-3-4-1-5(13)6(2-7(15)16)14-8(4)9(11)12/h1,9H,2-3H2,(H,15,16) |
| InChIKey | QTFGYBZZQVSMTD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|