C8H6F2N2O4 — CID 130088350
4-(difluoromethyl)-3-methyl-6-nitropyridine-2-carboxylic acid (PubChem CID 130088350) has the molecular formula C8H6F2N2O4 and a molecular weight of 232.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-methyl-6-nitropyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-3-methyl-6-nitropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 130088350 |
| Molecular Formula | C8H6F2N2O4 |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4-(difluoromethyl)-3-methyl-6-nitropyridine-2-carboxylic acid |
| SMILES | Cc1c(C(F)F)cc([N+](=O)[O-])nc1C(=O)O |
| InChI | InChI=1S/C8H6F2N2O4/c1-3-4(7(9)10)2-5(12(15)16)11-6(3)8(13)14/h2,7H,1H3,(H,13,14) |
| InChIKey | OVSCEKUNXKKBEE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|