C9H10ClF2NO — CID 130090443
[4-(chloromethyl)-5-(difluoromethyl)-3-methyl-2-pyridinyl]methanol (PubChem CID 130090443) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is [4-(chloromethyl)-5-(difluoromethyl)-3-methyl-2-pyridinyl]methanol.
| Compound Name | [4-(chloromethyl)-5-(difluoromethyl)-3-methyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130090443 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | [4-(chloromethyl)-5-(difluoromethyl)-3-methyl-2-pyridinyl]methanol |
| SMILES | Cc1c(CO)ncc(C(F)F)c1CCl |
| InChI | InChI=1S/C9H10ClF2NO/c1-5-6(2-10)7(9(11)12)3-13-8(5)4-14/h3,9,14H,2,4H2,1H3 |
| InChIKey | ZXPYKUXWVFNHAG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|