About 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide
2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide (PubChem CID 13009116) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide |
| PubChem CID | 13009116 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide |
| SMILES | CC(C)CNC(=O)CC(O)C(=O)NCC(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)6-13-11(16)5-10(15)12(17)14-7-9(3)4/h8-10,15H,5-7H2,1-4H3,(H,13,16)(H,14,17) |
| InChIKey | UWGRWSCITKTCQM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide?
The IUPAC name of 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide (CID 13009116) is 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide.
What is the SMILES notation for 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide?
The canonical SMILES for 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide is CC(C)CNC(=O)CC(O)C(=O)NCC(C)C.
What is the InChIKey of 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide?
The InChIKey is UWGRWSCITKTCQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-8(2)6-13-11(16)5-10(15)12(17)14-7-9(3)4/h8-10,15H,5-7H2,1-4H3,(H,13,16)(H,14,17).
What are the key properties of 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide?
2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide has a molecular weight of 244.33 g/mol, XLogP of 0.28, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,N'-bis(2-methylpropyl)butanediamide is sourced from PubChem (CID 13009116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).