C7H3F6NO2 — CID 130092905
3-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 130092905) has the molecular formula C7H3F6NO2 and a molecular weight of 247.09 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130092905 |
| Molecular Formula | C7H3F6NO2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 3-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C7H3F6NO2/c8-6(9,10)4-2-1-3(5(15)14-4)16-7(11,12)13/h1-2H,(H,14,15) |
| InChIKey | JIDNPBMRXPASFH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |