C6H3Br2F3N2O — CID 130093565
2,4-dibromo-6-(trifluoromethoxy)pyridin-3-amine (PubChem CID 130093565) has the molecular formula C6H3Br2F3N2O and a molecular weight of 335.91 g/mol. Its IUPAC name is 2,4-dibromo-6-(trifluoromethoxy)pyridin-3-amine.
| Compound Name | 2,4-dibromo-6-(trifluoromethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 130093565 |
| Molecular Formula | C6H3Br2F3N2O |
| Molecular Weight | 335.91 g/mol |
| Exact Mass | 333.86 |
| IUPAC Name | 2,4-dibromo-6-(trifluoromethoxy)pyridin-3-amine |
| SMILES | Nc1c(Br)cc(OC(F)(F)F)nc1Br |
| InChI | InChI=1S/C6H3Br2F3N2O/c7-2-1-3(14-6(9,10)11)13-5(8)4(2)12/h1H,12H2 |
| InChIKey | NXSFYZFWPXLBIO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|