C7H4Br2F3NO — CID 130093635
3,6-dibromo-4-methyl-2-(trifluoromethoxy)pyridine (PubChem CID 130093635) has the molecular formula C7H4Br2F3NO and a molecular weight of 334.92 g/mol. Its IUPAC name is 3,6-dibromo-4-methyl-2-(trifluoromethoxy)pyridine.
| Compound Name | 3,6-dibromo-4-methyl-2-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 130093635 |
| Molecular Formula | C7H4Br2F3NO |
| Molecular Weight | 334.92 g/mol |
| Exact Mass | 332.86 |
| IUPAC Name | 3,6-dibromo-4-methyl-2-(trifluoromethoxy)pyridine |
| SMILES | Cc1cc(Br)nc(OC(F)(F)F)c1Br |
| InChI | InChI=1S/C7H4Br2F3NO/c1-3-2-4(8)13-6(5(3)9)14-7(10,11)12/h2H,1H3 |
| InChIKey | WGYAUEZQQJBKCM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|