C29H31N3O4 — CID 13009643
(2R,3R,4R)-4-(2-aminopyrimidin-5-yl)-1,3,4-tris(phenylmethoxy)butan-2-ol (PubChem CID 13009643) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2R,3R,4R)-4-(2-aminopyrimidin-5-yl)-1,3,4-tris(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3R,4R)-4-(2-aminopyrimidin-5-yl)-1,3,4-tris(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 13009643 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (2R,3R,4R)-4-(2-aminopyrimidin-5-yl)-1,3,4-tris(phenylmethoxy)butan-2-ol |
| SMILES | Nc1ncc([C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](O)COCc2ccccc2)cn1 |
| InChI | InChI=1S/C29H31N3O4/c30-29-31-16-25(17-32-29)27(35-19-23-12-6-2-7-13-23)28(36-20-24-14-8-3-9-15-24)26(33)21-34-18-22-10-4-1-5-11-22/h1-17,26-28,33H,18-21H2,(H2,30,31,32)/t26-,27-,28-/m1/s1 |
| InChIKey | KHYLXQCYOSUPGX-JCYYIGJDSA-N |
| XLogP | 4.48 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |