C8H7F2NO3 — CID 130097491
4-(difluoromethyl)-6-methoxypyridine-3-carboxylic acid (PubChem CID 130097491) has the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-methoxypyridine-3-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-6-methoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130097491 |
| Molecular Formula | C8H7F2NO3 |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 4-(difluoromethyl)-6-methoxypyridine-3-carboxylic acid |
| SMILES | COc1cc(C(F)F)c(C(=O)O)cn1 |
| InChI | InChI=1S/C8H7F2NO3/c1-14-6-2-4(7(9)10)5(3-11-6)8(12)13/h2-3,7H,1H3,(H,12,13) |
| InChIKey | FHTMCDFOHROKRM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |