C7H7F2N3O2 — CID 130098779
3,4-diamino-5-(difluoromethyl)pyridine-2-carboxylic acid (PubChem CID 130098779) has the molecular formula C7H7F2N3O2 and a molecular weight of 203.15 g/mol. Its IUPAC name is 3,4-diamino-5-(difluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 3,4-diamino-5-(difluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 130098779 |
| Molecular Formula | C7H7F2N3O2 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3,4-diamino-5-(difluoromethyl)pyridine-2-carboxylic acid |
| SMILES | Nc1c(C(F)F)cnc(C(=O)O)c1N |
| InChI | InChI=1S/C7H7F2N3O2/c8-6(9)2-1-12-5(7(13)14)4(11)3(2)10/h1,6H,11H2,(H2,10,12)(H,13,14) |
| InChIKey | DUAQQZXLRCTLBS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |