3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid

C7H7F2N3O2 — CID 130098782

IUPAC3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid
SMILESNc1cc(N)c(C(F)F)nc1C(=O)O
InChIInChI=1S/C7H7F2N3O2/c8-6(9)4-2(10)1-3(11)5(12-4)7(13)14/h1,6H,10-11H2,(H,13,14)
InChIKeyPJQRPURIDOEAQS-UHFFFAOYSA-N
MW203.15 g/mol
LogP0.88
Rot. Bonds2

About 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid

3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid (PubChem CID 130098782) has the molecular formula C7H7F2N3O2 and a molecular weight of 203.15 g/mol. Its IUPAC name is 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid
PubChem CID130098782
Molecular FormulaC7H7F2N3O2
Molecular Weight203.15 g/mol
Exact Mass203.05
IUPAC Name3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid
SMILESNc1cc(N)c(C(F)F)nc1C(=O)O
InChIInChI=1S/C7H7F2N3O2/c8-6(9)4-2(10)1-3(11)5(12-4)7(13)14/h1,6H,10-11H2,(H,13,14)
InChIKeyPJQRPURIDOEAQS-UHFFFAOYSA-N
XLogP0.88
TPSA102.23 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.15
LogP ≤ 50.88
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid?
The IUPAC name of 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid (CID 130098782) is 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid?
The canonical SMILES for 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid is Nc1cc(N)c(C(F)F)nc1C(=O)O.
What is the InChIKey of 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid?
The InChIKey is PJQRPURIDOEAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2N3O2/c8-6(9)4-2(10)1-3(11)5(12-4)7(13)14/h1,6H,10-11H2,(H,13,14).
What are the key properties of 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid?
3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid has a molecular weight of 203.15 g/mol, XLogP of 0.88, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-6-(difluoromethyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 130098782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).