C6H3Br2F2NO — CID 130098897
2,5-dibromo-6-(difluoromethyl)pyridin-3-ol (PubChem CID 130098897) has the molecular formula C6H3Br2F2NO and a molecular weight of 302.90 g/mol. Its IUPAC name is 2,5-dibromo-6-(difluoromethyl)pyridin-3-ol.
| Compound Name | 2,5-dibromo-6-(difluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 130098897 |
| Molecular Formula | C6H3Br2F2NO |
| Molecular Weight | 302.90 g/mol |
| Exact Mass | 300.85 |
| IUPAC Name | 2,5-dibromo-6-(difluoromethyl)pyridin-3-ol |
| SMILES | Oc1cc(Br)c(C(F)F)nc1Br |
| InChI | InChI=1S/C6H3Br2F2NO/c7-2-1-3(12)5(8)11-4(2)6(9)10/h1,6,12H |
| InChIKey | UJOCVIKKLRLZHI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|