C7H5Br2F2N — CID 130098940
3,5-dibromo-4-(difluoromethyl)-2-methylpyridine (PubChem CID 130098940) has the molecular formula C7H5Br2F2N and a molecular weight of 300.93 g/mol. Its IUPAC name is 3,5-dibromo-4-(difluoromethyl)-2-methylpyridine.
| Compound Name | 3,5-dibromo-4-(difluoromethyl)-2-methylpyridine |
|---|---|
| PubChem CID | 130098940 |
| Molecular Formula | C7H5Br2F2N |
| Molecular Weight | 300.93 g/mol |
| Exact Mass | 298.88 |
| IUPAC Name | 3,5-dibromo-4-(difluoromethyl)-2-methylpyridine |
| SMILES | Cc1ncc(Br)c(C(F)F)c1Br |
| InChI | InChI=1S/C7H5Br2F2N/c1-3-6(9)5(7(10)11)4(8)2-12-3/h2,7H,1H3 |
| InChIKey | DLXKKJSBIZKIMC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |