C7H4Br2ClF2N — CID 130099019
2,6-dibromo-3-(chloromethyl)-5-(difluoromethyl)pyridine (PubChem CID 130099019) has the molecular formula C7H4Br2ClF2N and a molecular weight of 335.37 g/mol. Its IUPAC name is 2,6-dibromo-3-(chloromethyl)-5-(difluoromethyl)pyridine.
| Compound Name | 2,6-dibromo-3-(chloromethyl)-5-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 130099019 |
| Molecular Formula | C7H4Br2ClF2N |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 332.84 |
| IUPAC Name | 2,6-dibromo-3-(chloromethyl)-5-(difluoromethyl)pyridine |
| SMILES | FC(F)c1cc(CCl)c(Br)nc1Br |
| InChI | InChI=1S/C7H4Br2ClF2N/c8-5-3(2-10)1-4(7(11)12)6(9)13-5/h1,7H,2H2 |
| InChIKey | TUCTWFATVXKPGR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|