C7H5Cl2F2NO — CID 130099248
3,4-dichloro-5-(difluoromethyl)-2-methoxypyridine (PubChem CID 130099248) has the molecular formula C7H5Cl2F2NO and a molecular weight of 228.03 g/mol. Its IUPAC name is 3,4-dichloro-5-(difluoromethyl)-2-methoxypyridine.
| Compound Name | 3,4-dichloro-5-(difluoromethyl)-2-methoxypyridine |
|---|---|
| PubChem CID | 130099248 |
| Molecular Formula | C7H5Cl2F2NO |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 3,4-dichloro-5-(difluoromethyl)-2-methoxypyridine |
| SMILES | COc1ncc(C(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C7H5Cl2F2NO/c1-13-7-5(9)4(8)3(2-12-7)6(10)11/h2,6H,1H3 |
| InChIKey | KCEWGHLHGRKIJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |