C7H4Cl3F2N — CID 130099341
3,6-dichloro-4-(chloromethyl)-2-(difluoromethyl)pyridine (PubChem CID 130099341) has the molecular formula C7H4Cl3F2N and a molecular weight of 246.47 g/mol. Its IUPAC name is 3,6-dichloro-4-(chloromethyl)-2-(difluoromethyl)pyridine.
| Compound Name | 3,6-dichloro-4-(chloromethyl)-2-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 130099341 |
| Molecular Formula | C7H4Cl3F2N |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | 3,6-dichloro-4-(chloromethyl)-2-(difluoromethyl)pyridine |
| SMILES | FC(F)c1nc(Cl)cc(CCl)c1Cl |
| InChI | InChI=1S/C7H4Cl3F2N/c8-2-3-1-4(9)13-6(5(3)10)7(11)12/h1,7H,2H2 |
| InChIKey | JXPHWTDJZDXPMT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|