C7H3Cl2F2NO — CID 130099393
3,4-dichloro-5-(difluoromethyl)pyridine-2-carbaldehyde (PubChem CID 130099393) has the molecular formula C7H3Cl2F2NO and a molecular weight of 226.01 g/mol. Its IUPAC name is 3,4-dichloro-5-(difluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 3,4-dichloro-5-(difluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 130099393 |
| Molecular Formula | C7H3Cl2F2NO |
| Molecular Weight | 226.01 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | 3,4-dichloro-5-(difluoromethyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ncc(C(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl2F2NO/c8-5-3(7(10)11)1-12-4(2-13)6(5)9/h1-2,7H |
| InChIKey | PMMZNXVZGHGNFJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|