C7H5F4NO — CID 130099672
4-(difluoromethyl)-2,6-difluoro-3-methoxypyridine (PubChem CID 130099672) has the molecular formula C7H5F4NO and a molecular weight of 195.12 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,6-difluoro-3-methoxypyridine.
| Compound Name | 4-(difluoromethyl)-2,6-difluoro-3-methoxypyridine |
|---|---|
| PubChem CID | 130099672 |
| Molecular Formula | C7H5F4NO |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 4-(difluoromethyl)-2,6-difluoro-3-methoxypyridine |
| SMILES | COc1c(C(F)F)cc(F)nc1F |
| InChI | InChI=1S/C7H5F4NO/c1-13-5-3(6(9)10)2-4(8)12-7(5)11/h2,6H,1H3 |
| InChIKey | QCFRRMZQAXVHIK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|