C7H2F2I2N2 — CID 130100457
4-(difluoromethyl)-2,5-diiodopyridine-3-carbonitrile (PubChem CID 130100457) has the molecular formula C7H2F2I2N2 and a molecular weight of 405.91 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,5-diiodopyridine-3-carbonitrile.
| Compound Name | 4-(difluoromethyl)-2,5-diiodopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130100457 |
| Molecular Formula | C7H2F2I2N2 |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.83 |
| IUPAC Name | 4-(difluoromethyl)-2,5-diiodopyridine-3-carbonitrile |
| SMILES | N#Cc1c(I)ncc(I)c1C(F)F |
| InChI | InChI=1S/C7H2F2I2N2/c8-6(9)5-3(1-12)7(11)13-2-4(5)10/h2,6H |
| InChIKey | VLHDFHBSTJHRBJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|