C7H2ClF2I2NO — CID 130100732
3-(difluoromethyl)-2,6-diiodopyridine-4-carbonyl chloride (PubChem CID 130100732) has the molecular formula C7H2ClF2I2NO and a molecular weight of 443.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,6-diiodopyridine-4-carbonyl chloride.
| Compound Name | 3-(difluoromethyl)-2,6-diiodopyridine-4-carbonyl chloride |
|---|---|
| PubChem CID | 130100732 |
| Molecular Formula | C7H2ClF2I2NO |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.79 |
| IUPAC Name | 3-(difluoromethyl)-2,6-diiodopyridine-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(I)nc(I)c1C(F)F |
| InChI | InChI=1S/C7H2ClF2I2NO/c8-5(14)2-1-3(11)13-7(12)4(2)6(9)10/h1,6H |
| InChIKey | DATHBHPXFSPRLL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|