5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride

C7H2ClF2I2NO — CID 130100736

IUPAC5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride
SMILESO=C(Cl)c1ncc(C(F)F)c(I)c1I
InChIInChI=1S/C7H2ClF2I2NO/c8-6(14)5-4(12)3(11)2(1-13-5)7(9)10/h1,7H
InChIKeyRSAJAFBBYCXTIF-UHFFFAOYSA-N
MW443.36 g/mol
LogP3.61
Rot. Bonds2

About 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride

5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride (PubChem CID 130100736) has the molecular formula C7H2ClF2I2NO and a molecular weight of 443.36 g/mol. Its IUPAC name is 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride.

Molecular Properties

Compound Name5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride
PubChem CID130100736
Molecular FormulaC7H2ClF2I2NO
Molecular Weight443.36 g/mol
Exact Mass442.79
IUPAC Name5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride
SMILESO=C(Cl)c1ncc(C(F)F)c(I)c1I
InChIInChI=1S/C7H2ClF2I2NO/c8-6(14)5-4(12)3(11)2(1-13-5)7(9)10/h1,7H
InChIKeyRSAJAFBBYCXTIF-UHFFFAOYSA-N
XLogP3.61
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500443.36
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride?
The IUPAC name of 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride (CID 130100736) is 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride.
What is the SMILES notation for 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride?
The canonical SMILES for 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride is O=C(Cl)c1ncc(C(F)F)c(I)c1I.
What is the InChIKey of 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride?
The InChIKey is RSAJAFBBYCXTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF2I2NO/c8-6(14)5-4(12)3(11)2(1-13-5)7(9)10/h1,7H.
What are the key properties of 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride?
5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride has a molecular weight of 443.36 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-3,4-diiodopyridine-2-carbonyl chloride is sourced from PubChem (CID 130100736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).