C7H4F2I2N2O — CID 130100741
6-(difluoromethyl)-2,3-diiodopyridine-4-carboxamide (PubChem CID 130100741) has the molecular formula C7H4F2I2N2O and a molecular weight of 423.93 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,3-diiodopyridine-4-carboxamide.
| Compound Name | 6-(difluoromethyl)-2,3-diiodopyridine-4-carboxamide |
|---|---|
| PubChem CID | 130100741 |
| Molecular Formula | C7H4F2I2N2O |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.84 |
| IUPAC Name | 6-(difluoromethyl)-2,3-diiodopyridine-4-carboxamide |
| SMILES | NC(=O)c1cc(C(F)F)nc(I)c1I |
| InChI | InChI=1S/C7H4F2I2N2O/c8-5(9)3-1-2(7(12)14)4(10)6(11)13-3/h1,5H,(H2,12,14) |
| InChIKey | OXVMYYVHQGDCPD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|