About 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine
5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine (PubChem CID 130101103) has the molecular formula C8H8F3N
and a molecular weight of 175.15 g/mol. Its IUPAC name is 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine.
Analyze 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine?
The IUPAC name of 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine (CID 130101103) is 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine.
What is the SMILES notation for 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine?
The canonical SMILES for 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine is Cc1ncc(C(F)F)c(C)c1F.
What is the InChIKey of 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine?
The InChIKey is HRXKHQINUCKGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N/c1-4-6(8(10)11)3-12-5(2)7(4)9/h3,8H,1-2H3.
What are the key properties of 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine?
5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine has a molecular weight of 175.15 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-3-fluoro-2,4-dimethylpyridine is sourced from PubChem (CID 130101103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).