C8H8F2N2O2 — CID 130101216
6-(difluoromethyl)-2,3-dimethyl-4-nitropyridine (PubChem CID 130101216) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,3-dimethyl-4-nitropyridine.
| Compound Name | 6-(difluoromethyl)-2,3-dimethyl-4-nitropyridine |
|---|---|
| PubChem CID | 130101216 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 6-(difluoromethyl)-2,3-dimethyl-4-nitropyridine |
| SMILES | Cc1nc(C(F)F)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C8H8F2N2O2/c1-4-5(2)11-6(8(9)10)3-7(4)12(13)14/h3,8H,1-2H3 |
| InChIKey | JAQODMATCVKCKX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|