C9H9F2NO — CID 130101411
5-(difluoromethyl)-2,6-dimethylpyridine-3-carbaldehyde (PubChem CID 130101411) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 5-(difluoromethyl)-2,6-dimethylpyridine-3-carbaldehyde.
| Compound Name | 5-(difluoromethyl)-2,6-dimethylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 130101411 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5-(difluoromethyl)-2,6-dimethylpyridine-3-carbaldehyde |
| SMILES | Cc1nc(C)c(C(F)F)cc1C=O |
| InChI | InChI=1S/C9H9F2NO/c1-5-7(4-13)3-8(9(10)11)6(2)12-5/h3-4,9H,1-2H3 |
| InChIKey | DIZPTHWLJDVILI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|