C7H6BrClF2N2 — CID 130101968
5-bromo-2-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine (PubChem CID 130101968) has the molecular formula C7H6BrClF2N2 and a molecular weight of 271.49 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine.
| Compound Name | 5-bromo-2-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 130101968 |
| Molecular Formula | C7H6BrClF2N2 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-3-(difluoromethyl)pyridin-4-amine |
| SMILES | Nc1c(Br)cnc(CCl)c1C(F)F |
| InChI | InChI=1S/C7H6BrClF2N2/c8-3-2-13-4(1-9)5(6(3)12)7(10)11/h2,7H,1H2,(H2,12,13) |
| InChIKey | ZYMHPYJAVWNCCT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|